C10H14N2O4S — CID 81091134
2-[[4-(aminomethyl)phenyl]methylsulfamoyl]acetic acid (PubChem CID 81091134) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)phenyl]methylsulfamoyl]acetic acid.
| Compound Name | 2-[[4-(aminomethyl)phenyl]methylsulfamoyl]acetic acid |
|---|---|
| PubChem CID | 81091134 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[[4-(aminomethyl)phenyl]methylsulfamoyl]acetic acid |
| SMILES | NCc1ccc(CNS(=O)(=O)CC(=O)O)cc1 |
| InChI | InChI=1S/C10H14N2O4S/c11-5-8-1-3-9(4-2-8)6-12-17(15,16)7-10(13)14/h1-4,12H,5-7,11H2,(H,13,14) |
| InChIKey | QAGWHLUQMSXCNV-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |