methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate

C10H13BrN2O3 — CID 81091642

IUPACmethyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate
SMILESCOC(=O)C(Br)Cn1c(C)cc(C)nc1=O
InChIInChI=1S/C10H13BrN2O3/c1-6-4-7(2)13(10(15)12-6)5-8(11)9(14)16-3/h4,8H,5H2,1-3H3
InChIKeyRFBKUGCERVPADA-UHFFFAOYSA-N
MW289.13 g/mol
LogP0.80
Rot. Bonds3

About methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate

methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate (PubChem CID 81091642) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate
PubChem CID81091642
Molecular FormulaC10H13BrN2O3
Molecular Weight289.13 g/mol
Exact Mass288.01
IUPAC Namemethyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate
SMILESCOC(=O)C(Br)Cn1c(C)cc(C)nc1=O
InChIInChI=1S/C10H13BrN2O3/c1-6-4-7(2)13(10(15)12-6)5-8(11)9(14)16-3/h4,8H,5H2,1-3H3
InChIKeyRFBKUGCERVPADA-UHFFFAOYSA-N
XLogP0.80
TPSA61.19 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.13
LogP ≤ 50.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
The IUPAC name of methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate (CID 81091642) is methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate.
What is the SMILES notation for methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
The canonical SMILES for methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate is COC(=O)C(Br)Cn1c(C)cc(C)nc1=O.
What is the InChIKey of methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
The InChIKey is RFBKUGCERVPADA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2O3/c1-6-4-7(2)13(10(15)12-6)5-8(11)9(14)16-3/h4,8H,5H2,1-3H3.
What are the key properties of methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate has a molecular weight of 289.13 g/mol, XLogP of 0.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate is sourced from PubChem (CID 81091642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).