About methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate
methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate (PubChem CID 81091642) has the molecular formula C10H13BrN2O3
and a molecular weight of 289.13 g/mol. Its IUPAC name is methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate.
Molecular Properties
| Compound Name | methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate |
| PubChem CID | 81091642 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate |
| SMILES | COC(=O)C(Br)Cn1c(C)cc(C)nc1=O |
| InChI | InChI=1S/C10H13BrN2O3/c1-6-4-7(2)13(10(15)12-6)5-8(11)9(14)16-3/h4,8H,5H2,1-3H3 |
| InChIKey | RFBKUGCERVPADA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
The IUPAC name of methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate (CID 81091642) is methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate.
What is the SMILES notation for methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
The canonical SMILES for methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate is COC(=O)C(Br)Cn1c(C)cc(C)nc1=O.
What is the InChIKey of methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
The InChIKey is RFBKUGCERVPADA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2O3/c1-6-4-7(2)13(10(15)12-6)5-8(11)9(14)16-3/h4,8H,5H2,1-3H3.
What are the key properties of methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate has a molecular weight of 289.13 g/mol, XLogP of 0.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate is sourced from PubChem (CID 81091642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).