methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate

C11H13BrO3S — CID 81091823

IUPACmethyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate
SMILESCOC(=O)C(Br)COc1ccccc1SC
InChIInChI=1S/C11H13BrO3S/c1-14-11(13)8(12)7-15-9-5-3-4-6-10(9)16-2/h3-6,8H,7H2,1-2H3
InChIKeyZRIKMDGWBJLUHF-UHFFFAOYSA-N
MW305.19 g/mol
LogP2.72
Rot. Bonds5

About methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate

methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate (PubChem CID 81091823) has the molecular formula C11H13BrO3S and a molecular weight of 305.19 g/mol. Its IUPAC name is methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate.

Molecular Properties

Compound Namemethyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate
PubChem CID81091823
Molecular FormulaC11H13BrO3S
Molecular Weight305.19 g/mol
Exact Mass303.98
IUPAC Namemethyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate
SMILESCOC(=O)C(Br)COc1ccccc1SC
InChIInChI=1S/C11H13BrO3S/c1-14-11(13)8(12)7-15-9-5-3-4-6-10(9)16-2/h3-6,8H,7H2,1-2H3
InChIKeyZRIKMDGWBJLUHF-UHFFFAOYSA-N
XLogP2.72
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.19
LogP ≤ 52.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate?
The IUPAC name of methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate (CID 81091823) is methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate.
What is the SMILES notation for methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate?
The canonical SMILES for methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate is COC(=O)C(Br)COc1ccccc1SC.
What is the InChIKey of methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate?
The InChIKey is ZRIKMDGWBJLUHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO3S/c1-14-11(13)8(12)7-15-9-5-3-4-6-10(9)16-2/h3-6,8H,7H2,1-2H3.
What are the key properties of methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate?
methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate has a molecular weight of 305.19 g/mol, XLogP of 2.72, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-3-(2-methylsulfanylphenoxy)propanoate is sourced from PubChem (CID 81091823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).