About methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate
methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate (PubChem CID 81092372) has the molecular formula C7H9BrN2O2S2
and a molecular weight of 297.20 g/mol. Its IUPAC name is methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate.
Molecular Properties
| Compound Name | methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate |
| PubChem CID | 81092372 |
| Molecular Formula | C7H9BrN2O2S2 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 295.93 |
| IUPAC Name | methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate |
| SMILES | COC(=O)C(Br)CSc1nnc(C)s1 |
| InChI | InChI=1S/C7H9BrN2O2S2/c1-4-9-10-7(14-4)13-3-5(8)6(11)12-2/h5H,3H2,1-2H3 |
| InChIKey | DSAFDYAPENDWDP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
The IUPAC name of methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate (CID 81092372) is methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate.
What is the SMILES notation for methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
The canonical SMILES for methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate is COC(=O)C(Br)CSc1nnc(C)s1.
What is the InChIKey of methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
The InChIKey is DSAFDYAPENDWDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2O2S2/c1-4-9-10-7(14-4)13-3-5(8)6(11)12-2/h5H,3H2,1-2H3.
What are the key properties of methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate has a molecular weight of 297.20 g/mol, XLogP of 1.88, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate is sourced from PubChem (CID 81092372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).