2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid

C12H22O4S — CID 81093220

IUPAC2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid
SMILESCCOC(CSCC1(CC(=O)O)CC1)OCC
InChIInChI=1S/C12H22O4S/c1-3-15-11(16-4-2)8-17-9-12(5-6-12)7-10(13)14/h11H,3-9H2,1-2H3,(H,13,14)
InChIKeyKZNYUQQCRWIAEU-UHFFFAOYSA-N
MW262.37 g/mol
LogP2.37
Rot. Bonds10

About 2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid

2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid (PubChem CID 81093220) has the molecular formula C12H22O4S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid.

Molecular Properties

Compound Name2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid
PubChem CID81093220
Molecular FormulaC12H22O4S
Molecular Weight262.37 g/mol
Exact Mass262.12
IUPAC Name2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid
SMILESCCOC(CSCC1(CC(=O)O)CC1)OCC
InChIInChI=1S/C12H22O4S/c1-3-15-11(16-4-2)8-17-9-12(5-6-12)7-10(13)14/h11H,3-9H2,1-2H3,(H,13,14)
InChIKeyKZNYUQQCRWIAEU-UHFFFAOYSA-N
XLogP2.37
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.37
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid?
The IUPAC name of 2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid (CID 81093220) is 2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid.
What is the SMILES notation for 2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid?
The canonical SMILES for 2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid is CCOC(CSCC1(CC(=O)O)CC1)OCC.
What is the InChIKey of 2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid?
The InChIKey is KZNYUQQCRWIAEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4S/c1-3-15-11(16-4-2)8-17-9-12(5-6-12)7-10(13)14/h11H,3-9H2,1-2H3,(H,13,14).
What are the key properties of 2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid?
2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid has a molecular weight of 262.37 g/mol, XLogP of 2.37, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,2-diethoxyethylsulfanylmethyl)cyclopropyl]acetic acid is sourced from PubChem (CID 81093220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).