About 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline
5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline (PubChem CID 81093778) has the molecular formula C10H14ClNO2S
and a molecular weight of 247.75 g/mol. Its IUPAC name is 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline.
Molecular Properties
| Compound Name | 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline |
| PubChem CID | 81093778 |
| Molecular Formula | C10H14ClNO2S |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline |
| SMILES | COC(CSc1ccc(Cl)cc1N)OC |
| InChI | InChI=1S/C10H14ClNO2S/c1-13-10(14-2)6-15-9-4-3-7(11)5-8(9)12/h3-5,10H,6,12H2,1-2H3 |
| InChIKey | QYLIFGOTMHAUNZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline?
The IUPAC name of 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline (CID 81093778) is 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline.
What is the SMILES notation for 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline?
The canonical SMILES for 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline is COC(CSc1ccc(Cl)cc1N)OC.
What is the InChIKey of 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline?
The InChIKey is QYLIFGOTMHAUNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO2S/c1-13-10(14-2)6-15-9-4-3-7(11)5-8(9)12/h3-5,10H,6,12H2,1-2H3.
What are the key properties of 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline?
5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline has a molecular weight of 247.75 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(2,2-dimethoxyethylsulfanyl)aniline is sourced from PubChem (CID 81093778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).