C13H20FNO2S — CID 81093940
4-(3,3-diethoxypropylsulfanyl)-3-fluoroaniline (PubChem CID 81093940) has the molecular formula C13H20FNO2S and a molecular weight of 273.37 g/mol. Its IUPAC name is 4-(3,3-diethoxypropylsulfanyl)-3-fluoroaniline.
| Compound Name | 4-(3,3-diethoxypropylsulfanyl)-3-fluoroaniline |
|---|---|
| PubChem CID | 81093940 |
| Molecular Formula | C13H20FNO2S |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 4-(3,3-diethoxypropylsulfanyl)-3-fluoroaniline |
| SMILES | CCOC(CCSc1ccc(N)cc1F)OCC |
| InChI | InChI=1S/C13H20FNO2S/c1-3-16-13(17-4-2)7-8-18-12-6-5-10(15)9-11(12)14/h5-6,9,13H,3-4,7-8,15H2,1-2H3 |
| InChIKey | WSOBIAOGNYMRGZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|