C14H32N2O2 — CID 81094464
N-(2,2-diethoxyethyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 81094464) has the molecular formula C14H32N2O2 and a molecular weight of 260.42 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-(2,2-diethoxyethyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 81094464 |
| Molecular Formula | C14H32N2O2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | N-(2,2-diethoxyethyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CCOC(CNCCN(C(C)C)C(C)C)OCC |
| InChI | InChI=1S/C14H32N2O2/c1-7-17-14(18-8-2)11-15-9-10-16(12(3)4)13(5)6/h12-15H,7-11H2,1-6H3 |
| InChIKey | UZOZYJKKAIDKGU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|