C14H18N4O3 — CID 81094847
(2-propan-2-yl-1,2,4-triazol-3-yl)methyl 3-amino-5-methoxybenzoate (PubChem CID 81094847) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is (2-propan-2-yl-1,2,4-triazol-3-yl)methyl 3-amino-5-methoxybenzoate.
| Compound Name | (2-propan-2-yl-1,2,4-triazol-3-yl)methyl 3-amino-5-methoxybenzoate |
|---|---|
| PubChem CID | 81094847 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (2-propan-2-yl-1,2,4-triazol-3-yl)methyl 3-amino-5-methoxybenzoate |
| SMILES | COc1cc(N)cc(C(=O)OCc2ncnn2C(C)C)c1 |
| InChI | InChI=1S/C14H18N4O3/c1-9(2)18-13(16-8-17-18)7-21-14(19)10-4-11(15)6-12(5-10)20-3/h4-6,8-9H,7,15H2,1-3H3 |
| InChIKey | YJKROCYDMLBZHD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|