About N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide
N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide (PubChem CID 81095053) has the molecular formula C9H22N2O4S
and a molecular weight of 254.35 g/mol. Its IUPAC name is N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide |
| PubChem CID | 81095053 |
| Molecular Formula | C9H22N2O4S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide |
| SMILES | CCOC(CNCCNS(C)(=O)=O)OCC |
| InChI | InChI=1S/C9H22N2O4S/c1-4-14-9(15-5-2)8-10-6-7-11-16(3,12)13/h9-11H,4-8H2,1-3H3 |
| InChIKey | OEZZLIRWHYDTCR-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide?
The IUPAC name of N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide (CID 81095053) is N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide.
What is the SMILES notation for N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide?
The canonical SMILES for N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide is CCOC(CNCCNS(C)(=O)=O)OCC.
What is the InChIKey of N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide?
The InChIKey is OEZZLIRWHYDTCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O4S/c1-4-14-9(15-5-2)8-10-6-7-11-16(3,12)13/h9-11H,4-8H2,1-3H3.
What are the key properties of N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide?
N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide has a molecular weight of 254.35 g/mol, XLogP of -0.48, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2-diethoxyethylamino)ethyl]methanesulfonamide is sourced from PubChem (CID 81095053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).