2-(2,2-diethoxyethylsulfanyl)acetic acid

C8H16O4S — CID 81095194

IUPAC2-(2,2-diethoxyethylsulfanyl)acetic acid
SMILESCCOC(CSCC(=O)O)OCC
InChIInChI=1S/C8H16O4S/c1-3-11-8(12-4-2)6-13-5-7(9)10/h8H,3-6H2,1-2H3,(H,9,10)
InChIKeyOYBUYYKWOMHSOB-UHFFFAOYSA-N
MW208.28 g/mol
LogP1.20
Rot. Bonds8

About 2-(2,2-diethoxyethylsulfanyl)acetic acid

2-(2,2-diethoxyethylsulfanyl)acetic acid (PubChem CID 81095194) has the molecular formula C8H16O4S and a molecular weight of 208.28 g/mol. Its IUPAC name is 2-(2,2-diethoxyethylsulfanyl)acetic acid.

Molecular Properties

Compound Name2-(2,2-diethoxyethylsulfanyl)acetic acid
PubChem CID81095194
Molecular FormulaC8H16O4S
Molecular Weight208.28 g/mol
Exact Mass208.08
IUPAC Name2-(2,2-diethoxyethylsulfanyl)acetic acid
SMILESCCOC(CSCC(=O)O)OCC
InChIInChI=1S/C8H16O4S/c1-3-11-8(12-4-2)6-13-5-7(9)10/h8H,3-6H2,1-2H3,(H,9,10)
InChIKeyOYBUYYKWOMHSOB-UHFFFAOYSA-N
XLogP1.20
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.28
LogP ≤ 51.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-(2,2-diethoxyethylsulfanyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-diethoxyethylsulfanyl)acetic acid?
The IUPAC name of 2-(2,2-diethoxyethylsulfanyl)acetic acid (CID 81095194) is 2-(2,2-diethoxyethylsulfanyl)acetic acid.
What is the SMILES notation for 2-(2,2-diethoxyethylsulfanyl)acetic acid?
The canonical SMILES for 2-(2,2-diethoxyethylsulfanyl)acetic acid is CCOC(CSCC(=O)O)OCC.
What is the InChIKey of 2-(2,2-diethoxyethylsulfanyl)acetic acid?
The InChIKey is OYBUYYKWOMHSOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4S/c1-3-11-8(12-4-2)6-13-5-7(9)10/h8H,3-6H2,1-2H3,(H,9,10).
What are the key properties of 2-(2,2-diethoxyethylsulfanyl)acetic acid?
2-(2,2-diethoxyethylsulfanyl)acetic acid has a molecular weight of 208.28 g/mol, XLogP of 1.20, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diethoxyethylsulfanyl)acetic acid is sourced from PubChem (CID 81095194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).