About 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene
3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene (PubChem CID 81095474) has the molecular formula C15H17Br2ClS
and a molecular weight of 424.63 g/mol. Its IUPAC name is 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene.
Molecular Properties
| Compound Name | 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene |
| PubChem CID | 81095474 |
| Molecular Formula | C15H17Br2ClS |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 421.91 |
| IUPAC Name | 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene |
| SMILES | ClC(c1cc(Br)sc1Br)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C15H17Br2ClS/c16-12-6-11(15(17)19-12)14(18)13-9-2-7-1-8(4-9)5-10(13)3-7/h6-10,13-14H,1-5H2 |
| InChIKey | NZNRZGRFRYKXSS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene?
The IUPAC name of 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene (CID 81095474) is 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene.
What is the SMILES notation for 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene?
The canonical SMILES for 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene is ClC(c1cc(Br)sc1Br)C1C2CC3CC(C2)CC1C3.
What is the InChIKey of 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene?
The InChIKey is NZNRZGRFRYKXSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Br2ClS/c16-12-6-11(15(17)19-12)14(18)13-9-2-7-1-8(4-9)5-10(13)3-7/h6-10,13-14H,1-5H2.
What are the key properties of 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene?
3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene has a molecular weight of 424.63 g/mol, XLogP of 6.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-adamantyl(chloro)methyl]-2,5-dibromothiophene is sourced from PubChem (CID 81095474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).