About [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine
[6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine (PubChem CID 81096122) has the molecular formula C14H19N5
and a molecular weight of 257.34 g/mol. Its IUPAC name is [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine |
| PubChem CID | 81096122 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine |
| SMILES | NCc1ccc(-c2nncn2C2CCCCC2)nc1 |
| InChI | InChI=1S/C14H19N5/c15-8-11-6-7-13(16-9-11)14-18-17-10-19(14)12-4-2-1-3-5-12/h6-7,9-10,12H,1-5,8,15H2 |
| InChIKey | JQVUWLJUOMMBFC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine?
The IUPAC name of [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine (CID 81096122) is [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine.
What is the SMILES notation for [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine?
The canonical SMILES for [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine is NCc1ccc(-c2nncn2C2CCCCC2)nc1.
What is the InChIKey of [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine?
The InChIKey is JQVUWLJUOMMBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5/c15-8-11-6-7-13(16-9-11)14-18-17-10-19(14)12-4-2-1-3-5-12/h6-7,9-10,12H,1-5,8,15H2.
What are the key properties of [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine?
[6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine has a molecular weight of 257.34 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-cyclohexyl-1,2,4-triazol-3-yl)-3-pyridinyl]methanamine is sourced from PubChem (CID 81096122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).