C15H26N4O — CID 81096185
2-[2-amino-1-(1-methylpyrazol-4-yl)ethyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81096185) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[2-amino-1-(1-methylpyrazol-4-yl)ethyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[2-amino-1-(1-methylpyrazol-4-yl)ethyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81096185 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-[2-amino-1-(1-methylpyrazol-4-yl)ethyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | Cn1cc(C(CN)N2CCC3(O)CCCCC3C2)cn1 |
| InChI | InChI=1S/C15H26N4O/c1-18-10-12(9-17-18)14(8-16)19-7-6-15(20)5-3-2-4-13(15)11-19/h9-10,13-14,20H,2-8,11,16H2,1H3 |
| InChIKey | SNOIXCUKGZCACR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |