C15H27N3O3 — CID 81096502
[1-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-methyl-1-oxobutan-2-yl]urea (PubChem CID 81096502) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is [1-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-methyl-1-oxobutan-2-yl]urea.
| Compound Name | [1-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-methyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 81096502 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | [1-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-3-methyl-1-oxobutan-2-yl]urea |
| SMILES | CC(C)C(NC(N)=O)C(=O)N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C15H27N3O3/c1-10(2)12(17-14(16)20)13(19)18-8-7-15(21)6-4-3-5-11(15)9-18/h10-12,21H,3-9H2,1-2H3,(H3,16,17,20) |
| InChIKey | ATQGJUXTOKKDQO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |