About 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine
5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine (PubChem CID 81096508) has the molecular formula C13H17IN2O
and a molecular weight of 344.20 g/mol. Its IUPAC name is 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine |
| PubChem CID | 81096508 |
| Molecular Formula | C13H17IN2O |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine |
| SMILES | Nc1noc(C2C3CC4CC(C3)CC2C4)c1I |
| InChI | InChI=1S/C13H17IN2O/c14-11-12(17-16-13(11)15)10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2,(H2,15,16) |
| InChIKey | PQOFTZPYTGWMJL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine?
The IUPAC name of 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine (CID 81096508) is 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine.
What is the SMILES notation for 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine?
The canonical SMILES for 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine is Nc1noc(C2C3CC4CC(C3)CC2C4)c1I.
What is the InChIKey of 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine?
The InChIKey is PQOFTZPYTGWMJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17IN2O/c14-11-12(17-16-13(11)15)10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2,(H2,15,16).
What are the key properties of 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine?
5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine has a molecular weight of 344.20 g/mol, XLogP of 3.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-adamantyl)-4-iodo-1,2-oxazol-3-amine is sourced from PubChem (CID 81096508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).