C14H21N3O2 — CID 81096509
(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-amino-1H-pyrrol-2-yl)methanone (PubChem CID 81096509) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-amino-1H-pyrrol-2-yl)methanone.
| Compound Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-amino-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 81096509 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-amino-1H-pyrrol-2-yl)methanone |
| SMILES | Nc1c[nH]c(C(=O)N2CCC3(O)CCCCC3C2)c1 |
| InChI | InChI=1S/C14H21N3O2/c15-11-7-12(16-8-11)13(18)17-6-5-14(19)4-2-1-3-10(14)9-17/h7-8,10,16,19H,1-6,9,15H2 |
| InChIKey | NRQSDTDNLSNDAA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |