C15H20FIN2O — CID 81096630
2-(2-amino-5-fluoro-4-iodophenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81096630) has the molecular formula C15H20FIN2O and a molecular weight of 390.24 g/mol. Its IUPAC name is 2-(2-amino-5-fluoro-4-iodophenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-(2-amino-5-fluoro-4-iodophenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81096630 |
| Molecular Formula | C15H20FIN2O |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-(2-amino-5-fluoro-4-iodophenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | Nc1cc(I)c(F)cc1N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C15H20FIN2O/c16-11-7-14(13(18)8-12(11)17)19-6-5-15(20)4-2-1-3-10(15)9-19/h7-8,10,20H,1-6,9,18H2 |
| InChIKey | AELWTVQVJWXYBK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|