About 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol
1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol (PubChem CID 81096659) has the molecular formula C10H19F3N2O
and a molecular weight of 240.27 g/mol. Its IUPAC name is 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol |
| PubChem CID | 81096659 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol |
| SMILES | CC1(O)CCN(C(CCN)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H19F3N2O/c1-9(16)3-6-15(7-4-9)8(2-5-14)10(11,12)13/h8,16H,2-7,14H2,1H3 |
| InChIKey | BADLKPUPKUBCEJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol?
The IUPAC name of 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol (CID 81096659) is 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol.
What is the SMILES notation for 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol?
The canonical SMILES for 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol is CC1(O)CCN(C(CCN)C(F)(F)F)CC1.
What is the InChIKey of 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol?
The InChIKey is BADLKPUPKUBCEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O/c1-9(16)3-6-15(7-4-9)8(2-5-14)10(11,12)13/h8,16H,2-7,14H2,1H3.
What are the key properties of 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol?
1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol has a molecular weight of 240.27 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylpiperidin-4-ol is sourced from PubChem (CID 81096659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).