C17H24FNO2 — CID 81097071
2-[3-fluoro-2-(1-hydroxyethyl)phenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81097071) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-[3-fluoro-2-(1-hydroxyethyl)phenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[3-fluoro-2-(1-hydroxyethyl)phenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81097071 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 2-[3-fluoro-2-(1-hydroxyethyl)phenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CC(O)c1c(F)cccc1N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C17H24FNO2/c1-12(20)16-14(18)6-4-7-15(16)19-10-9-17(21)8-3-2-5-13(17)11-19/h4,6-7,12-13,20-21H,2-3,5,8-11H2,1H3 |
| InChIKey | BWIZTJPITJLYCO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |