C17H24N2OS — CID 81097111
2-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81097111) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81097111 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | NCC#Cc1ccsc1CN1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C17H24N2OS/c18-9-3-4-14-6-11-21-16(14)13-19-10-8-17(20)7-2-1-5-15(17)12-19/h6,11,15,20H,1-2,5,7-10,12-13,18H2 |
| InChIKey | NHUNMPAEKOWIDI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|