C14H18F3N3O — CID 81098239
2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81098239) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81098239 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | OC12CCCCC1CN(c1nccc(C(F)(F)F)n1)CC2 |
| InChI | InChI=1S/C14H18F3N3O/c15-14(16,17)11-4-7-18-12(19-11)20-8-6-13(21)5-2-1-3-10(13)9-20/h4,7,10,21H,1-3,5-6,8-9H2 |
| InChIKey | ZELBYNRQYDKFAD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |