About 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane
2-[bromo-(3,4-dichlorophenyl)methyl]adamantane (PubChem CID 81099309) has the molecular formula C17H19BrCl2
and a molecular weight of 374.15 g/mol. Its IUPAC name is 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane.
Molecular Properties
| Compound Name | 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane |
| PubChem CID | 81099309 |
| Molecular Formula | C17H19BrCl2 |
| Molecular Weight | 374.15 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane |
| SMILES | Clc1ccc(C(Br)C2C3CC4CC(C3)CC2C4)cc1Cl |
| InChI | InChI=1S/C17H19BrCl2/c18-17(11-1-2-14(19)15(20)8-11)16-12-4-9-3-10(6-12)7-13(16)5-9/h1-2,8-10,12-13,16-17H,3-7H2 |
| InChIKey | VXRUFHRPDCRQGV-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.15 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane?
The IUPAC name of 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane (CID 81099309) is 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane.
What is the SMILES notation for 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane?
The canonical SMILES for 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane is Clc1ccc(C(Br)C2C3CC4CC(C3)CC2C4)cc1Cl.
What is the InChIKey of 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane?
The InChIKey is VXRUFHRPDCRQGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19BrCl2/c18-17(11-1-2-14(19)15(20)8-11)16-12-4-9-3-10(6-12)7-13(16)5-9/h1-2,8-10,12-13,16-17H,3-7H2.
What are the key properties of 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane?
2-[bromo-(3,4-dichlorophenyl)methyl]adamantane has a molecular weight of 374.15 g/mol, XLogP of 6.50, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bromo-(3,4-dichlorophenyl)methyl]adamantane is sourced from PubChem (CID 81099309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).