C17H28N2OS — CID 81100142
2-[2-amino-1-(3-methylthiophen-2-yl)propyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81100142) has the molecular formula C17H28N2OS and a molecular weight of 308.49 g/mol. Its IUPAC name is 2-[2-amino-1-(3-methylthiophen-2-yl)propyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[2-amino-1-(3-methylthiophen-2-yl)propyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81100142 |
| Molecular Formula | C17H28N2OS |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 2-[2-amino-1-(3-methylthiophen-2-yl)propyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | Cc1ccsc1C(C(C)N)N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C17H28N2OS/c1-12-6-10-21-16(12)15(13(2)18)19-9-8-17(20)7-4-3-5-14(17)11-19/h6,10,13-15,20H,3-5,7-9,11,18H2,1-2H3 |
| InChIKey | OUHQYOGQJNEAGK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |