About 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol
2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol (PubChem CID 81100258) has the molecular formula C19H25FO
and a molecular weight of 288.41 g/mol. Its IUPAC name is 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol.
Molecular Properties
| Compound Name | 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol |
| PubChem CID | 81100258 |
| Molecular Formula | C19H25FO |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol |
| SMILES | Cc1cc(C(O)C2C3CC4CC(C3)CC2C4)cc(C)c1F |
| InChI | InChI=1S/C19H25FO/c1-10-3-16(4-11(2)18(10)20)19(21)17-14-6-12-5-13(8-14)9-15(17)7-12/h3-4,12-15,17,19,21H,5-9H2,1-2H3 |
| InChIKey | BTBXYEYVAVVHEE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol?
The IUPAC name of 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol (CID 81100258) is 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol.
What is the SMILES notation for 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol?
The canonical SMILES for 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol is Cc1cc(C(O)C2C3CC4CC(C3)CC2C4)cc(C)c1F.
What is the InChIKey of 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol?
The InChIKey is BTBXYEYVAVVHEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25FO/c1-10-3-16(4-11(2)18(10)20)19(21)17-14-6-12-5-13(8-14)9-15(17)7-12/h3-4,12-15,17,19,21H,5-9H2,1-2H3.
What are the key properties of 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol?
2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol has a molecular weight of 288.41 g/mol, XLogP of 4.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-adamantyl-(4-fluoro-3,5-dimethylphenyl)methanol is sourced from PubChem (CID 81100258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).