C15H17ClN4 — CID 81100557
3-(2-adamantyl)-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 81100557) has the molecular formula C15H17ClN4 and a molecular weight of 288.78 g/mol. Its IUPAC name is 3-(2-adamantyl)-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-(2-adamantyl)-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 81100557 |
| Molecular Formula | C15H17ClN4 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-(2-adamantyl)-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Clc1ccc2nnc(C3C4CC5CC(C4)CC3C5)n2n1 |
| InChI | InChI=1S/C15H17ClN4/c16-12-1-2-13-17-18-15(20(13)19-12)14-10-4-8-3-9(6-10)7-11(14)5-8/h1-2,8-11,14H,3-7H2 |
| InChIKey | YUXSANWZWLZXFM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |