C14H30N2O — CID 81100821
1-(3,3-diethylpyrrolidin-1-yl)-5-methoxypentan-2-amine (PubChem CID 81100821) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-(3,3-diethylpyrrolidin-1-yl)-5-methoxypentan-2-amine.
| Compound Name | 1-(3,3-diethylpyrrolidin-1-yl)-5-methoxypentan-2-amine |
|---|---|
| PubChem CID | 81100821 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 1-(3,3-diethylpyrrolidin-1-yl)-5-methoxypentan-2-amine |
| SMILES | CCC1(CC)CCN(CC(N)CCCOC)C1 |
| InChI | InChI=1S/C14H30N2O/c1-4-14(5-2)8-9-16(12-14)11-13(15)7-6-10-17-3/h13H,4-12,15H2,1-3H3 |
| InChIKey | NHCPDXABGLLXPB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|