About 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide
3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide (PubChem CID 81101445) has the molecular formula C9H18N2O3
and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide.
Molecular Properties
| Compound Name | 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide |
| PubChem CID | 81101445 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide |
| SMILES | CNC(=O)CCNCC1CCOCO1 |
| InChI | InChI=1S/C9H18N2O3/c1-10-9(12)2-4-11-6-8-3-5-13-7-14-8/h8,11H,2-7H2,1H3,(H,10,12) |
| InChIKey | QGSHAZJCWBVSCV-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide?
The IUPAC name of 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide (CID 81101445) is 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide.
What is the SMILES notation for 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide?
The canonical SMILES for 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide is CNC(=O)CCNCC1CCOCO1.
What is the InChIKey of 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide?
The InChIKey is QGSHAZJCWBVSCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3/c1-10-9(12)2-4-11-6-8-3-5-13-7-14-8/h8,11H,2-7H2,1H3,(H,10,12).
What are the key properties of 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide?
3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide has a molecular weight of 202.25 g/mol, XLogP of -0.52, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxan-4-ylmethylamino)-N-methylpropanamide is sourced from PubChem (CID 81101445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).