About N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide
N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide (PubChem CID 81101560) has the molecular formula C12H24N2O3
and a molecular weight of 244.33 g/mol. Its IUPAC name is N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide.
Molecular Properties
| Compound Name | N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide |
| PubChem CID | 81101560 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide |
| SMILES | CCC(C)NC(=O)CCNCC1CCOCO1 |
| InChI | InChI=1S/C12H24N2O3/c1-3-10(2)14-12(15)4-6-13-8-11-5-7-16-9-17-11/h10-11,13H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | FBFSHXJCIKMKGM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide?
The IUPAC name of N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide (CID 81101560) is N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide.
What is the SMILES notation for N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide?
The canonical SMILES for N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide is CCC(C)NC(=O)CCNCC1CCOCO1.
What is the InChIKey of N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide?
The InChIKey is FBFSHXJCIKMKGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3/c1-3-10(2)14-12(15)4-6-13-8-11-5-7-16-9-17-11/h10-11,13H,3-9H2,1-2H3,(H,14,15).
What are the key properties of N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide?
N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide has a molecular weight of 244.33 g/mol, XLogP of 0.64, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-3-(1,3-dioxan-4-ylmethylamino)propanamide is sourced from PubChem (CID 81101560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).