C11H12F3NO2 — CID 81101688
N-(1,3-dioxan-4-ylmethyl)-3,4,5-trifluoroaniline (PubChem CID 81101688) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-3,4,5-trifluoroaniline.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-3,4,5-trifluoroaniline |
|---|---|
| PubChem CID | 81101688 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-3,4,5-trifluoroaniline |
| SMILES | Fc1cc(NCC2CCOCO2)cc(F)c1F |
| InChI | InChI=1S/C11H12F3NO2/c12-9-3-7(4-10(13)11(9)14)15-5-8-1-2-16-6-17-8/h3-4,8,15H,1-2,5-6H2 |
| InChIKey | BBBHOAYJJSQZAI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|