About 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol
2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol (PubChem CID 81101798) has the molecular formula C11H23NO3
and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol.
Molecular Properties
| Compound Name | 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol |
| PubChem CID | 81101798 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)NCC1CCOCO1 |
| InChI | InChI=1S/C11H23NO3/c1-9(2)5-10(7-13)12-6-11-3-4-14-8-15-11/h9-13H,3-8H2,1-2H3 |
| InChIKey | ROIHZMLETJHDTG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol?
The IUPAC name of 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol (CID 81101798) is 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol.
What is the SMILES notation for 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol?
The canonical SMILES for 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol is CC(C)CC(CO)NCC1CCOCO1.
What is the InChIKey of 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol?
The InChIKey is ROIHZMLETJHDTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3/c1-9(2)5-10(7-13)12-6-11-3-4-14-8-15-11/h9-13H,3-8H2,1-2H3.
What are the key properties of 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol?
2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol has a molecular weight of 217.31 g/mol, XLogP of 0.75, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxan-4-ylmethylamino)-4-methylpentan-1-ol is sourced from PubChem (CID 81101798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).