About 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine
5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine (PubChem CID 81101853) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine.
Molecular Properties
| Compound Name | 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine |
| PubChem CID | 81101853 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine |
| SMILES | C=CCN(CC=C)CC(N)CCCOC |
| InChI | InChI=1S/C12H24N2O/c1-4-8-14(9-5-2)11-12(13)7-6-10-15-3/h4-5,12H,1-2,6-11,13H2,3H3 |
| InChIKey | RYQUFRHGICXMOA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine?
The IUPAC name of 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine (CID 81101853) is 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine.
What is the SMILES notation for 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine?
The canonical SMILES for 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine is C=CCN(CC=C)CC(N)CCCOC.
What is the InChIKey of 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine?
The InChIKey is RYQUFRHGICXMOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-4-8-14(9-5-2)11-12(13)7-6-10-15-3/h4-5,12H,1-2,6-11,13H2,3H3.
What are the key properties of 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine?
5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine has a molecular weight of 212.34 g/mol, XLogP of 1.41, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine is sourced from PubChem (CID 81101853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).