C12H23N3O3 — CID 81102716
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-amino-3-methoxypropanamide (PubChem CID 81102716) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-amino-3-methoxypropanamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-amino-3-methoxypropanamide |
|---|---|
| PubChem CID | 81102716 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-amino-3-methoxypropanamide |
| SMILES | COCC(N)C(=O)NCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C12H23N3O3/c1-17-8-11(13)12(16)14-5-10-6-15-4-2-3-9(15)7-18-10/h9-11H,2-8,13H2,1H3,(H,14,16) |
| InChIKey | CLDNBHVQMDLBPG-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |