C16H30BrNO — CID 81102920
2-[2-(bromomethyl)-2-ethylbutyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81102920) has the molecular formula C16H30BrNO and a molecular weight of 332.33 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-2-ethylbutyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[2-(bromomethyl)-2-ethylbutyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81102920 |
| Molecular Formula | C16H30BrNO |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[2-(bromomethyl)-2-ethylbutyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CCC(CC)(CBr)CN1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C16H30BrNO/c1-3-15(4-2,12-17)13-18-10-9-16(19)8-6-5-7-14(16)11-18/h14,19H,3-13H2,1-2H3 |
| InChIKey | NNKSFGMQCXWCCY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|