C12H18N4O3 — CID 81103963
6-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2H-1,2,4-triazine-3,5-dione (PubChem CID 81103963) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 81103963 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 6-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(N2CCC3(O)CCCCC3C2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H18N4O3/c17-10-9(14-15-11(18)13-10)16-6-5-12(19)4-2-1-3-8(12)7-16/h8,19H,1-7H2,(H2,13,15,17,18) |
| InChIKey | WJPFCIQXVPAYMS-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |