C11H11F2NO2 — CID 81104270
1-(2,2-difluoroethyl)-7,8-dihydro-6H-quinoline-2,5-dione (PubChem CID 81104270) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-7,8-dihydro-6H-quinoline-2,5-dione.
| Compound Name | 1-(2,2-difluoroethyl)-7,8-dihydro-6H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 81104270 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)-7,8-dihydro-6H-quinoline-2,5-dione |
| SMILES | O=C1CCCc2c1ccc(=O)n2CC(F)F |
| InChI | InChI=1S/C11H11F2NO2/c12-10(13)6-14-8-2-1-3-9(15)7(8)4-5-11(14)16/h4-5,10H,1-3,6H2 |
| InChIKey | NYFRZNWYXUSSFL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |