2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid

C11H13NO3 — CID 81104414

IUPAC2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid
SMILESO=C(O)CC1CCCc2[nH]c(=O)ccc21
InChIInChI=1S/C11H13NO3/c13-10-5-4-8-7(6-11(14)15)2-1-3-9(8)12-10/h4-5,7H,1-3,6H2,(H,12,13)(H,14,15)
InChIKeyZTZBMLBJSWHGQN-UHFFFAOYSA-N
MW207.23 g/mol
LogP1.27
Rot. Bonds2

About 2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid

2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid (PubChem CID 81104414) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid
PubChem CID81104414
Molecular FormulaC11H13NO3
Molecular Weight207.23 g/mol
Exact Mass207.09
IUPAC Name2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid
SMILESO=C(O)CC1CCCc2[nH]c(=O)ccc21
InChIInChI=1S/C11H13NO3/c13-10-5-4-8-7(6-11(14)15)2-1-3-9(8)12-10/h4-5,7H,1-3,6H2,(H,12,13)(H,14,15)
InChIKeyZTZBMLBJSWHGQN-UHFFFAOYSA-N
XLogP1.27
TPSA70.16 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 51.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid?
The IUPAC name of 2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid (CID 81104414) is 2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid.
What is the SMILES notation for 2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid?
The canonical SMILES for 2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid is O=C(O)CC1CCCc2[nH]c(=O)ccc21.
What is the InChIKey of 2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid?
The InChIKey is ZTZBMLBJSWHGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c13-10-5-4-8-7(6-11(14)15)2-1-3-9(8)12-10/h4-5,7H,1-3,6H2,(H,12,13)(H,14,15).
What are the key properties of 2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid?
2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid has a molecular weight of 207.23 g/mol, XLogP of 1.27, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)acetic acid is sourced from PubChem (CID 81104414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).