About (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide
(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide (PubChem CID 81105122) has the molecular formula C10H10BF3NO2-
and a molecular weight of 244.00 g/mol. Its IUPAC name is (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide.
Molecular Properties
| Compound Name | (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide |
| PubChem CID | 81105122 |
| Molecular Formula | C10H10BF3NO2- |
| Molecular Weight | 244.00 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide |
| SMILES | O=C1CCCc2c1ccc(=O)n2C[B-](F)(F)F |
| InChI | InChI=1S/C10H10BF3NO2/c12-11(13,14)6-15-8-2-1-3-9(16)7(8)4-5-10(15)17/h4-5H,1-3,6H2/q-1 |
| InChIKey | VIACPXOSVHNJBY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.00 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide?
The IUPAC name of (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide (CID 81105122) is (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide.
What is the SMILES notation for (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide?
The canonical SMILES for (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide is O=C1CCCc2c1ccc(=O)n2C[B-](F)(F)F.
What is the InChIKey of (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide?
The InChIKey is VIACPXOSVHNJBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BF3NO2/c12-11(13,14)6-15-8-2-1-3-9(16)7(8)4-5-10(15)17/h4-5H,1-3,6H2/q-1.
What are the key properties of (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide?
(2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide has a molecular weight of 244.00 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxo-7,8-dihydro-6H-quinolin-1-yl)methyl-trifluoroboranuide is sourced from PubChem (CID 81105122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).