About 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran
5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran (PubChem CID 81105664) has the molecular formula C17H12BrFOS
and a molecular weight of 363.25 g/mol. Its IUPAC name is 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran |
| PubChem CID | 81105664 |
| Molecular Formula | C17H12BrFOS |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran |
| SMILES | Fc1ccc2cc(C(Br)c3ccc4c(c3)COC4)sc2c1 |
| InChI | InChI=1S/C17H12BrFOS/c18-17(11-1-2-12-8-20-9-13(12)5-11)16-6-10-3-4-14(19)7-15(10)21-16/h1-7,17H,8-9H2 |
| InChIKey | TUKVQERZVKXGNG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran?
The IUPAC name of 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran (CID 81105664) is 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran?
The canonical SMILES for 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran is Fc1ccc2cc(C(Br)c3ccc4c(c3)COC4)sc2c1.
What is the InChIKey of 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran?
The InChIKey is TUKVQERZVKXGNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12BrFOS/c18-17(11-1-2-12-8-20-9-13(12)5-11)16-6-10-3-4-14(19)7-15(10)21-16/h1-7,17H,8-9H2.
What are the key properties of 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran?
5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran has a molecular weight of 363.25 g/mol, XLogP of 5.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bromo-(6-fluoro-1-benzothiophen-2-yl)methyl]-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 81105664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).