C13H21FN2 — CID 81105778
3-[[3-fluoropropyl(propan-2-yl)amino]methyl]aniline (PubChem CID 81105778) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 3-[[3-fluoropropyl(propan-2-yl)amino]methyl]aniline.
| Compound Name | 3-[[3-fluoropropyl(propan-2-yl)amino]methyl]aniline |
|---|---|
| PubChem CID | 81105778 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 3-[[3-fluoropropyl(propan-2-yl)amino]methyl]aniline |
| SMILES | CC(C)N(CCCF)Cc1cccc(N)c1 |
| InChI | InChI=1S/C13H21FN2/c1-11(2)16(8-4-7-14)10-12-5-3-6-13(15)9-12/h3,5-6,9,11H,4,7-8,10,15H2,1-2H3 |
| InChIKey | JRBRRPHPHVQJDP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|