C9H8Cl2FN3S — CID 81105913
3,5-dichloro-N-(3-fluoropropyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 81105913) has the molecular formula C9H8Cl2FN3S and a molecular weight of 280.15 g/mol. Its IUPAC name is 3,5-dichloro-N-(3-fluoropropyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | 3,5-dichloro-N-(3-fluoropropyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 81105913 |
| Molecular Formula | C9H8Cl2FN3S |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 3,5-dichloro-N-(3-fluoropropyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | FCCCNc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C9H8Cl2FN3S/c10-5-4-6(11)8-9(15-16-14-8)7(5)13-3-1-2-12/h4,13H,1-3H2 |
| InChIKey | YFAUXWRMOBIMOO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|