C14H20FNO2 — CID 81106162
N-[[2-(3-fluoropropoxy)-5-methoxyphenyl]methyl]cyclopropanamine (PubChem CID 81106162) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is N-[[2-(3-fluoropropoxy)-5-methoxyphenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(3-fluoropropoxy)-5-methoxyphenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 81106162 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-[[2-(3-fluoropropoxy)-5-methoxyphenyl]methyl]cyclopropanamine |
| SMILES | COc1ccc(OCCCF)c(CNC2CC2)c1 |
| InChI | InChI=1S/C14H20FNO2/c1-17-13-5-6-14(18-8-2-7-15)11(9-13)10-16-12-3-4-12/h5-6,9,12,16H,2-4,7-8,10H2,1H3 |
| InChIKey | RWIPQMGTWKUUQG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|