C13H20FNO2 — CID 81106283
N-[[2-(3-fluoropropoxy)-3-methoxyphenyl]methyl]ethanamine (PubChem CID 81106283) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is N-[[2-(3-fluoropropoxy)-3-methoxyphenyl]methyl]ethanamine.
| Compound Name | N-[[2-(3-fluoropropoxy)-3-methoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 81106283 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-[[2-(3-fluoropropoxy)-3-methoxyphenyl]methyl]ethanamine |
| SMILES | CCNCc1cccc(OC)c1OCCCF |
| InChI | InChI=1S/C13H20FNO2/c1-3-15-10-11-6-4-7-12(16-2)13(11)17-9-5-8-14/h4,6-7,15H,3,5,8-10H2,1-2H3 |
| InChIKey | XHNLUXOHXUKTQC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|