About 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione
1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione (PubChem CID 81106487) has the molecular formula C12H14FNO2
and a molecular weight of 223.25 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione.
Molecular Properties
| Compound Name | 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione |
| PubChem CID | 81106487 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione |
| SMILES | O=C1CCCc2c1ccc(=O)n2CCCF |
| InChI | InChI=1S/C12H14FNO2/c13-7-2-8-14-10-3-1-4-11(15)9(10)5-6-12(14)16/h5-6H,1-4,7-8H2 |
| InChIKey | VKRLWHPQLHJKDE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione?
The IUPAC name of 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione (CID 81106487) is 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione.
What is the SMILES notation for 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione?
The canonical SMILES for 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione is O=C1CCCc2c1ccc(=O)n2CCCF.
What is the InChIKey of 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione?
The InChIKey is VKRLWHPQLHJKDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO2/c13-7-2-8-14-10-3-1-4-11(15)9(10)5-6-12(14)16/h5-6H,1-4,7-8H2.
What are the key properties of 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione?
1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione has a molecular weight of 223.25 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluoropropyl)-7,8-dihydro-6H-quinoline-2,5-dione is sourced from PubChem (CID 81106487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).