C11H16FNO2 — CID 81106628
[4-(3-fluoropropoxy)-3-methoxyphenyl]methanamine (PubChem CID 81106628) has the molecular formula C11H16FNO2 and a molecular weight of 213.25 g/mol. Its IUPAC name is [4-(3-fluoropropoxy)-3-methoxyphenyl]methanamine.
| Compound Name | [4-(3-fluoropropoxy)-3-methoxyphenyl]methanamine |
|---|---|
| PubChem CID | 81106628 |
| Molecular Formula | C11H16FNO2 |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | [4-(3-fluoropropoxy)-3-methoxyphenyl]methanamine |
| SMILES | COc1cc(CN)ccc1OCCCF |
| InChI | InChI=1S/C11H16FNO2/c1-14-11-7-9(8-13)3-4-10(11)15-6-2-5-12/h3-4,7H,2,5-6,8,13H2,1H3 |
| InChIKey | VGWQIDNEFSTCEH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|