C11H25FN2 — CID 81106814
2-N-(3-fluoropropyl)-1-N,1-N,4-trimethylpentane-1,2-diamine (PubChem CID 81106814) has the molecular formula C11H25FN2 and a molecular weight of 204.33 g/mol. Its IUPAC name is 2-N-(3-fluoropropyl)-1-N,1-N,4-trimethylpentane-1,2-diamine.
| Compound Name | 2-N-(3-fluoropropyl)-1-N,1-N,4-trimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 81106814 |
| Molecular Formula | C11H25FN2 |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.20 |
| IUPAC Name | 2-N-(3-fluoropropyl)-1-N,1-N,4-trimethylpentane-1,2-diamine |
| SMILES | CC(C)CC(CN(C)C)NCCCF |
| InChI | InChI=1S/C11H25FN2/c1-10(2)8-11(9-14(3)4)13-7-5-6-12/h10-11,13H,5-9H2,1-4H3 |
| InChIKey | DPFZCWSWIMBPJD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|