About N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine
N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine (PubChem CID 81107202) has the molecular formula C11H22FN
and a molecular weight of 187.30 g/mol. Its IUPAC name is N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine |
| PubChem CID | 81107202 |
| Molecular Formula | C11H22FN |
| Molecular Weight | 187.30 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine |
| SMILES | CC1(C)CCCCC1NCCCF |
| InChI | InChI=1S/C11H22FN/c1-11(2)7-4-3-6-10(11)13-9-5-8-12/h10,13H,3-9H2,1-2H3 |
| InChIKey | HVVLJLKFNQUOJG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine?
The IUPAC name of N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine (CID 81107202) is N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine.
What is the SMILES notation for N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine?
The canonical SMILES for N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine is CC1(C)CCCCC1NCCCF.
What is the InChIKey of N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine?
The InChIKey is HVVLJLKFNQUOJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22FN/c1-11(2)7-4-3-6-10(11)13-9-5-8-12/h10,13H,3-9H2,1-2H3.
What are the key properties of N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine?
N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine has a molecular weight of 187.30 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluoropropyl)-2,2-dimethylcyclohexan-1-amine is sourced from PubChem (CID 81107202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).