C14H17N3O3 — CID 81107463
1-methyl-3-[(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)amino]pyrrolidine-2,5-dione (PubChem CID 81107463) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-methyl-3-[(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | 1-methyl-3-[(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 81107463 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-methyl-3-[(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)amino]pyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(NC2CCCc3[nH]c(=O)ccc32)C1=O |
| InChI | InChI=1S/C14H17N3O3/c1-17-13(19)7-11(14(17)20)15-9-3-2-4-10-8(9)5-6-12(18)16-10/h5-6,9,11,15H,2-4,7H2,1H3,(H,16,18) |
| InChIKey | UYQJMXUOVFCZPA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|