C15H21N5O — CID 81107620
2-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81107620) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 2-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81107620 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | Cc1cc(N2CCC3(O)CCCCC3C2)n2ncnc2n1 |
| InChI | InChI=1S/C15H21N5O/c1-11-8-13(20-14(18-11)16-10-17-20)19-7-6-15(21)5-3-2-4-12(15)9-19/h8,10,12,21H,2-7,9H2,1H3 |
| InChIKey | QLWHWAKHBSSOLK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |