C17H29N3O — CID 81107911
2-[(1-butan-2-ylpyrazol-3-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81107911) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-[(1-butan-2-ylpyrazol-3-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[(1-butan-2-ylpyrazol-3-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81107911 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 2-[(1-butan-2-ylpyrazol-3-yl)methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CCC(C)n1ccc(CN2CCC3(O)CCCCC3C2)n1 |
| InChI | InChI=1S/C17H29N3O/c1-3-14(2)20-10-7-16(18-20)13-19-11-9-17(21)8-5-4-6-15(17)12-19/h7,10,14-15,21H,3-6,8-9,11-13H2,1-2H3 |
| InChIKey | RPMNXYCXTOOFPD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |